CAS 863453-61-6 appears in our catalog under these names: (5R)-2,2-Dioxido-5-methyl-1,2,3-oxathiazolidine, n-boc protected, 95%, (R)-tert-Butyl 5-methyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide 95%, (R)-tert-Butyl 5-methyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 97%, 97%, (5R)-2,2-DIOXIDO-5-METHYL-1,2,3-OXATHIAZOLIDINE, N-BOC PROTECTED, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 25g, 10g, 50g, 100g.
Tert-butyl (5R)-5-methyl-2,2-dioxooxathiazolidine-3-carboxylate (CAS 863453-61-6) is a chemical compound with the molecular formula C8H15NO5S and a molecular weight of 237.28 g/mol. IUPAC name: tert-butyl (5R)-5-methyl-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: ZGFOJWQAHCHOLG-ZCFIWIBFSA-N.
| Molecular formula | C8H15NO5S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | tert-butyl (5R)-5-methyl-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | ZGFOJWQAHCHOLG-ZCFIWIBFSA-N |
| SMILES | C[C@@H]1CN(S(=O)(=O)O1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)