Products 1059732-17-0

CAS 1059732-17-0 is the registry number for 2-((4-Hydroxy-1,1-dioxidotetrahydrothiophen-3-yl)amino)butanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]butanoic acid (CAS 1059732-17-0) is a chemical compound with the molecular formula C8H15NO5S and a molecular weight of 237.28 g/mol. IUPAC name: 2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]butanoic acid. InChIKey: BSZFUFJEQWHURV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15NO5S
Molecular weight237.28 g/mol
IUPAC name2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]butanoic acid
InChIKeyBSZFUFJEQWHURV-UHFFFAOYSA-N
SMILESCCC(C(=O)O)NC1CS(=O)(=O)CC1O

Computed by PubChem (NCBI)