CAS 439948-91-1 appears in our catalog under these names: (4S)-2,2-Dioxido-4-methyl-1,2,3-oxathiazolidine, n-boc protected, 95%, (S)-tert-Butyl 4-methyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide, 98%, (S)–tert–Butyl 4–methyl–1,2,3–oxathiazolidine–3–carboxylate 2,2–dioxide, (4S)-2,2-Dioxido-4-methyl-1,2,3-oxathiazolidine, N-BOC protected, (S)-tert-Butyl 4-methyl-1,2,3-oxathiazolidine-3-carboxylate 2,2-dioxide 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 1g, 25g, 10g, 100g, 500g, 50g.
Tert-butyl (4S)-4-methyl-2,2-dioxooxathiazolidine-3-carboxylate (CAS 439948-91-1) is a chemical compound with the molecular formula C8H15NO5S and a molecular weight of 237.28 g/mol. IUPAC name: tert-butyl (4S)-4-methyl-2,2-dioxooxathiazolidine-3-carboxylate. InChIKey: NFAKQWFVEAEEPG-LURJTMIESA-N.
| Molecular formula | C8H15NO5S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | tert-butyl (4S)-4-methyl-2,2-dioxooxathiazolidine-3-carboxylate |
| InChIKey | NFAKQWFVEAEEPG-LURJTMIESA-N |
| SMILES | C[C@H]1COS(=O)(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)