cas: 17257-71-5 — see every product listed under this CAS number, including other names
(S)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetic acid 97% (CAS 17257-71-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A257946-100mg |
| cas | 17257-71-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1799.94 Pln | |
| Ambeed | 25g | 5944.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A257946 |
(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid (CAS 17257-71-5) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid. InChIKey: JJYKJUXBWFATTE-VIFPVBQESA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid |
| InChIKey | JJYKJUXBWFATTE-VIFPVBQESA-N |
| SMILES | CO[C@@](C1=CC=CC=C1)(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)