cas: 63430-98-8 — see every product listed under this CAS number, including other names
(S)-1,2,3,4-Tetrahydro-quinoline-2-carboxylic acid, HCl, 97%, 97% (CAS 63430-98-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EAPG-100mg |
| cas | 63430-98-8 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 573.20 Pln | |
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 500mg | 1178.00 Pln | |
| Chemat | 1g | 1917.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride (CAS 63430-98-8) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: (2S)-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride. InChIKey: QCFTXGXKUNDYFE-FVGYRXGTSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | (2S)-1,2,3,4-tetrahydroquinoline-2-carboxylic acid;hydrochloride |
| InChIKey | QCFTXGXKUNDYFE-FVGYRXGTSA-N |
| SMILES | C1CC2=CC=CC=C2N[C@@H]1C(=O)O.Cl |
Computed by PubChem (NCBI)