cas: 136552-06-2 — see every product listed under this CAS number, including other names
(S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)azetidine-2-carboxylic acid, 97%, 97% (CAS 136552-06-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CIK-100mg |
| cas | 136552-06-2 |
| size | 100mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 500mg | 112.40 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 338.00 Pln | |
| Chemat | 10g | 544.40 Pln | |
| Chemat | 25g | 1096.40 Pln | |
| Chemat | 50g | 2061.20 Pln | |
| Chemat | 250g | 5589.20 Pln | |
| Chemat | 500g | 10315.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid (CAS 136552-06-2) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid. InChIKey: BXRZCDISGRVJCA-KRWDZBQOSA-N.
| Molecular formula | C19H17NO4 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid |
| InChIKey | BXRZCDISGRVJCA-KRWDZBQOSA-N |
| SMILES | C1CN([C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)