cas: 136552-06-2 — see every product listed under this CAS number, including other names
(S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)azetidine-2-carboxylic acid, 98% (CAS 136552-06-2) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F217798-500MG |
| cas | 136552-06-2 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 159.34 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 471.73 Pln | |
| Fluorochem | 10g | 706.02 Pln | |
| Fluorochem | 25g | 1414.10 Pln | |
| Fluorochem | 50g | 2778.21 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid (CAS 136552-06-2) is a chemical compound with the molecular formula C19H17NO4 and a molecular weight of 323.3 g/mol. IUPAC name: (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid. InChIKey: BXRZCDISGRVJCA-KRWDZBQOSA-N.
| Molecular formula | C19H17NO4 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | (2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)azetidine-2-carboxylic acid |
| InChIKey | BXRZCDISGRVJCA-KRWDZBQOSA-N |
| SMILES | C1CN([C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)