cas: 1353006-50-4 — see every product listed under this CAS number, including other names
(S)-1-(3,5-Dimethoxyphenyl)ethanamine hydrochloride, 98%, 98% (CAS 1353006-50-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HU1S-100mg |
| cas | 1353006-50-4 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 5g | 1643.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1S)-1-(3,5-dimethoxyphenyl)ethanamine;hydrochloride (CAS 1353006-50-4) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: (1S)-1-(3,5-dimethoxyphenyl)ethanamine;hydrochloride. InChIKey: YUPSTPMVIYAHMF-FJXQXJEOSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | (1S)-1-(3,5-dimethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | YUPSTPMVIYAHMF-FJXQXJEOSA-N |
| SMILES | C[C@@H](C1=CC(=CC(=C1)OC)OC)N.Cl |
Computed by PubChem (NCBI)