CAS 84771-33-5 is the registry number for (S)-1-Tritylaziridine-2-carboxylic acid. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-tritylaziridine-2-carboxylic acid (CAS 84771-33-5) is a chemical compound with the molecular formula C22H19NO2 and a molecular weight of 329.4 g/mol. IUPAC name: 1-tritylaziridine-2-carboxylic acid. InChIKey: BXSIPZGNIBVSLK-UHFFFAOYSA-N.
| Molecular formula | C22H19NO2 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 1-tritylaziridine-2-carboxylic acid |
| InChIKey | BXSIPZGNIBVSLK-UHFFFAOYSA-N |
| SMILES | C1C(N1C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)O |
Computed by PubChem (NCBI)