CAS 81477-91-0 appears in our catalog under these names: N–(diphenylmethylene) Glycine benzyl ester, Diphenylmethylene-glycine benzyl ester, 98%, 98%, Diphenylmethylene-glycine benzyl ester, 99.01%, Diphenylmethylene-glycine benzyl ester, 98%, Diphenylmethylene-glycine benzyl ester, 95%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 5g, 500mg, 25g, 100g, 50g, 250g.
Benzyl 2-(benzhydrylideneamino)acetate (CAS 81477-91-0) is a chemical compound with the molecular formula C22H19NO2 and a molecular weight of 329.4 g/mol. IUPAC name: benzyl 2-(benzhydrylideneamino)acetate. InChIKey: KFNIDRLZPBRDNJ-UHFFFAOYSA-N.
| Molecular formula | C22H19NO2 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | benzyl 2-(benzhydrylideneamino)acetate |
| InChIKey | KFNIDRLZPBRDNJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CN=C(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)