CAS 74449-34-6 is the registry number for N-Benzoyl-N-(2-phenylethyl)benzamide. Offered by: TRC. Available pack sizes: 1g.
N-benzoyl-N-(2-phenylethyl)benzamide (CAS 74449-34-6) is a chemical compound with the molecular formula C22H19NO2 and a molecular weight of 329.4 g/mol. IUPAC name: N-benzoyl-N-(2-phenylethyl)benzamide. InChIKey: DXMWDXBVIDJHBJ-UHFFFAOYSA-N.
| Molecular formula | C22H19NO2 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | N-benzoyl-N-(2-phenylethyl)benzamide |
| InChIKey | DXMWDXBVIDJHBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCN(C(=O)C2=CC=CC=C2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)