CAS 88109-06-2 appears in our catalog under these names: N-Trityl-l-serine lactone, 95%, N-Trityl-L-serine lactone, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
(3S)-3-(tritylamino)oxetan-2-one (CAS 88109-06-2) is a chemical compound with the molecular formula C22H19NO2 and a molecular weight of 329.4 g/mol. IUPAC name: (3S)-3-(tritylamino)oxetan-2-one. InChIKey: WKOYUOGPQDPOFV-FQEVSTJZSA-N.
| Molecular formula | C22H19NO2 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | (3S)-3-(tritylamino)oxetan-2-one |
| InChIKey | WKOYUOGPQDPOFV-FQEVSTJZSA-N |
| SMILES | C1[C@@H](C(=O)O1)NC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)