CAS 4790-19-6 appears in our catalog under these names: 5,6-Bis(benzyloxy)-1h-indole, 95%, 5,6-Bis(benzyloxy)-1H-indole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 100mg, 1g.
5,6-bis(phenylmethoxy)-1H-indole (CAS 4790-19-6) is a chemical compound with the molecular formula C22H19NO2 and a molecular weight of 329.4 g/mol. IUPAC name: 5,6-bis(phenylmethoxy)-1H-indole. InChIKey: JEUGWNYIRZKHDS-UHFFFAOYSA-N.
| Molecular formula | C22H19NO2 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 5,6-bis(phenylmethoxy)-1H-indole |
| InChIKey | JEUGWNYIRZKHDS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C3C(=C2)C=CN3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)