CAS 1203447-95-3 appears in our catalog under these names: Solifenacin Impurity 3, Phenyl (S)-1-Phenyl-1,2,3,4-tetrahydroisoquinoline-2-carboxylate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
Phenyl (1S)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (CAS 1203447-95-3) is a chemical compound with the molecular formula C22H19NO2 and a molecular weight of 329.4 g/mol. IUPAC name: phenyl (1S)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate. InChIKey: MYKZRJDFFPSMQX-NRFANRHFSA-N.
| Molecular formula | C22H19NO2 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | phenyl (1S)-1-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| InChIKey | MYKZRJDFFPSMQX-NRFANRHFSA-N |
| SMILES | C1CN([C@H](C2=CC=CC=C21)C3=CC=CC=C3)C(=O)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)