Products 191090-40-1
CAS 191090-40-1 appears in our catalog under these names: (R)–(+)–5,5–Diphenyl–4–benzyl–2–oxazolidinone, 2-Oxazolidinone, 5,5-diphenyl-4-(phenylmethyl)-, (4R)-. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
(4R)-4-benzyl-5,5-diphenyl-1,3-oxazolidin-2-one (CAS 191090-40-1) is a chemical compound with the molecular formula C22H19NO2 and a molecular weight of 329.4 g/mol. IUPAC name: (4R)-4-benzyl-5,5-diphenyl-1,3-oxazolidin-2-one. InChIKey: XVHANMSUSBZRCX-HXUWFJFHSA-N.
| Molecular formula | C22H19NO2 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | (4R)-4-benzyl-5,5-diphenyl-1,3-oxazolidin-2-one |
| InChIKey | XVHANMSUSBZRCX-HXUWFJFHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H]2C(OC(=O)N2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)