cas: 191599-51-6 — see every product listed under this CAS number, including other names
(S)-1-tert-Butyl 3-ethyl piperidine-1,3-dicarboxylate, 97%, 97% (CAS 191599-51-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148MV-250mg |
| cas | 191599-51-6 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 798.80 Pln | |
| Chemat | 10g | 1288.40 Pln | |
| Chemat | 25g | 2757.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 3-O-ethyl (3S)-piperidine-1,3-dicarboxylate (CAS 191599-51-6) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3S)-piperidine-1,3-dicarboxylate. InChIKey: YCXCRFGBFZTUSU-JTQLQIEISA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3S)-piperidine-1,3-dicarboxylate |
| InChIKey | YCXCRFGBFZTUSU-JTQLQIEISA-N |
| SMILES | CCOC(=O)[C@H]1CCCN(C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)