cas: 191599-51-6 — see every product listed under this CAS number, including other names
Ethyl (S)-N-Boc-piperidine-3-carboxylate 97% (CAS 191599-51-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A499260-250mg |
| cas | 191599-51-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 470.50 Pln | |
| Ambeed | 5g | 1221.44 Pln | |
| Ambeed | 10g | 2022.44 Pln | |
| Ambeed | 25g | 4358.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A499260 |
1-O-tert-butyl 3-O-ethyl (3S)-piperidine-1,3-dicarboxylate (CAS 191599-51-6) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3S)-piperidine-1,3-dicarboxylate. InChIKey: YCXCRFGBFZTUSU-JTQLQIEISA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3S)-piperidine-1,3-dicarboxylate |
| InChIKey | YCXCRFGBFZTUSU-JTQLQIEISA-N |
| SMILES | CCOC(=O)[C@H]1CCCN(C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)