cas: 135944-05-7 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methyl-3-phenylpropanoic acid, 98%, 98% (CAS 135944-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110B29-100mg |
| cas | 135944-05-7 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 794.00 Pln | |
| Chemat | 10g | 1350.80 Pln | |
| Chemat | 25g | 2838.80 Pln | |
| Chemat | 250g | 7437.20 Pln | |
| Chemat | 500g | 13416.00 Pln | |
| Chemat | 1kg | 22326.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-phenylpropanoic acid (CAS 135944-05-7) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-phenylpropanoic acid. InChIKey: KLBKBAAOPOXFSK-VWLOTQADSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methyl-3-phenylpropanoic acid |
| InChIKey | KLBKBAAOPOXFSK-VWLOTQADSA-N |
| SMILES | C[C@](CC1=CC=CC=C1)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)