cas: 138662-62-1 — see every product listed under this CAS number, including other names
(S)-2-Amino-3,3-diphenylpropanoic acid hydrochloride, 98% (CAS 138662-62-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F553778-100MG |
| cas | 138662-62-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 732.05 Pln | |
| Fluorochem | 1g | 1887.89 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-amino-3,3-diphenylpropanoic acid;hydrochloride (CAS 138662-62-1) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 277.74 g/mol. IUPAC name: (2S)-2-amino-3,3-diphenylpropanoic acid;hydrochloride. InChIKey: SKIHATSEIBREBX-UQKRIMTDSA-N.
| Molecular formula | C15H16ClNO2 |
|---|---|
| Molecular weight | 277.74 g/mol |
| IUPAC name | (2S)-2-amino-3,3-diphenylpropanoic acid;hydrochloride |
| InChIKey | SKIHATSEIBREBX-UQKRIMTDSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)