CAS 138662-62-1 appears in our catalog under these names: (S)-2-Amino-3,3-diphenylpropanoic acid hydrochloride, 95%, (S)-2-Amino-3,3-diphenylpropanoic acid hydrochloride, 98%, 98%, (S)-2-Amino-3,3-diphenylpropanoic acid hydrochloride, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(2S)-2-amino-3,3-diphenylpropanoic acid;hydrochloride (CAS 138662-62-1) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 277.74 g/mol. IUPAC name: (2S)-2-amino-3,3-diphenylpropanoic acid;hydrochloride. InChIKey: SKIHATSEIBREBX-UQKRIMTDSA-N.
| Molecular formula | C15H16ClNO2 |
|---|---|
| Molecular weight | 277.74 g/mol |
| IUPAC name | (2S)-2-amino-3,3-diphenylpropanoic acid;hydrochloride |
| InChIKey | SKIHATSEIBREBX-UQKRIMTDSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)