Products 1033194-62-5
CAS 1033194-62-5 is the registry number for tert-Butyl 6-chloro-2-methylquinoline-4-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl 6-chloro-2-methylquinoline-4-carboxylate (CAS 1033194-62-5) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 277.74 g/mol. IUPAC name: tert-butyl 6-chloro-2-methylquinoline-4-carboxylate. InChIKey: KFTZRUWMBAAWHA-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO2 |
|---|---|
| Molecular weight | 277.74 g/mol |
| IUPAC name | tert-butyl 6-chloro-2-methylquinoline-4-carboxylate |
| InChIKey | KFTZRUWMBAAWHA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=CC2=N1)Cl)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)