CAS 1355247-33-4 is the registry number for Ethyl 4-(4-aminophenyl)benzoate hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Ethyl 4-(4-aminophenyl)benzoate;hydrochloride (CAS 1355247-33-4) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 277.74 g/mol. IUPAC name: ethyl 4-(4-aminophenyl)benzoate;hydrochloride. InChIKey: TVEQCKMBIAUZSV-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO2 |
|---|---|
| Molecular weight | 277.74 g/mol |
| IUPAC name | ethyl 4-(4-aminophenyl)benzoate;hydrochloride |
| InChIKey | TVEQCKMBIAUZSV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)