Products 1355247-33-4

CAS 1355247-33-4 is the registry number for Ethyl 4-(4-aminophenyl)benzoate hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 4-(4-aminophenyl)benzoate;hydrochloride (CAS 1355247-33-4) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 277.74 g/mol. IUPAC name: ethyl 4-(4-aminophenyl)benzoate;hydrochloride. InChIKey: TVEQCKMBIAUZSV-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16ClNO2
Molecular weight277.74 g/mol
IUPAC nameethyl 4-(4-aminophenyl)benzoate;hydrochloride
InChIKeyTVEQCKMBIAUZSV-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)N.Cl

Computed by PubChem (NCBI)