CAS 1049734-17-9 is the registry number for (+/-)-Trans-4-(2-naphthyl)-pyrrolidine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3R,4S)-4-naphthalen-2-ylpyrrolidine-3-carboxylic acid;hydrochloride (CAS 1049734-17-9) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 277.74 g/mol. IUPAC name: (3R,4S)-4-naphthalen-2-ylpyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: NBYIHOUCABZEHP-DFQHDRSWSA-N.
| Molecular formula | C15H16ClNO2 |
|---|---|
| Molecular weight | 277.74 g/mol |
| IUPAC name | (3R,4S)-4-naphthalen-2-ylpyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | NBYIHOUCABZEHP-DFQHDRSWSA-N |
| SMILES | C1[C@@H]([C@H](CN1)C(=O)O)C2=CC3=CC=CC=C3C=C2.Cl |
Computed by PubChem (NCBI)