Products 63024-23-7
CAS 63024-23-7 appears in our catalog under these names: Dl-3-(4-biphenyl)alanine hydrochloride, 95%, 3-((1,1'-Biphenyl)-4-yl)-2-aminopropanoic acid hydrochloride, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
2-amino-3-(4-phenylphenyl)propanoic acid;hydrochloride (CAS 63024-23-7) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 277.74 g/mol. IUPAC name: 2-amino-3-(4-phenylphenyl)propanoic acid;hydrochloride. InChIKey: ZUZSOLFZHJQIAX-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO2 |
|---|---|
| Molecular weight | 277.74 g/mol |
| IUPAC name | 2-amino-3-(4-phenylphenyl)propanoic acid;hydrochloride |
| InChIKey | ZUZSOLFZHJQIAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
2-amino-3-(4-phenylphenyl)propanoic Acid Hydrochloride, 2-amino-3-(4-phenylphenyl)propanoic acid;hydrochloride, 3-([1,1'-Biphenyl]-4-yl)-2-aminopropanoic acid hydrochloride, 4-Phenylphenylalanine--hydrogen chloride (1/1), 2-Amino-3-([1,1'-biphenyl]-4-yl)propanoic acid--hydrogen chloride (1/1)