CAS 64375-68-4 is the registry number for 4-(4-Chloro-6-methoxy-2-methylquinolin-3-yl)butan-2-one, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(4-chloro-6-methoxy-2-methylquinolin-3-yl)butan-2-one (CAS 64375-68-4) is a chemical compound with the molecular formula C15H16ClNO2 and a molecular weight of 277.74 g/mol. IUPAC name: 4-(4-chloro-6-methoxy-2-methylquinolin-3-yl)butan-2-one. InChIKey: WFVYBTVDLFICII-UHFFFAOYSA-N.
| Molecular formula | C15H16ClNO2 |
|---|---|
| Molecular weight | 277.74 g/mol |
| IUPAC name | 4-(4-chloro-6-methoxy-2-methylquinolin-3-yl)butan-2-one |
| InChIKey | WFVYBTVDLFICII-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C2C=C(C=CC2=N1)OC)Cl)CCC(=O)C |
Computed by PubChem (NCBI)