cas: 123053-22-5 — see every product listed under this CAS number, including other names
(S)-2-Amino-3-(3-chlorophenyl)propanoic acid hydrochloride, 97.0% (CAS 123053-22-5) is a chemical reagent available from Chemat. Available pack sizes: 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W022471-1 g |
| cas | 123053-22-5 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 240.74 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
(2S)-2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride (CAS 123053-22-5) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: (2S)-2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride. InChIKey: MLKORXUFSMVSBB-QRPNPIFTSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | (2S)-2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride |
| InChIKey | MLKORXUFSMVSBB-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)