CAS 123053-22-5 appears in our catalog under these names: (S)-2-Amino-3-(3-chlorophenyl)propanoic acid hydrochloride, 95%, (S)–2–Amino–3–(3–chlorophenyl)propanoic acid hydrochloride, (S)-2-Amino-3-(3-chlorophenyl)propanoic acid hydrochloride, 97%, 97%, (S)-2-Amino-3-(3-chlorophenyl)propanoic acid hydrochloride, 97.0%, 3-Chloro-phenylalanine hydrochloride, >99%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg, 1 g.
(2S)-2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride (CAS 123053-22-5) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: (2S)-2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride. InChIKey: MLKORXUFSMVSBB-QRPNPIFTSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | (2S)-2-amino-3-(3-chlorophenyl)propanoic acid;hydrochloride |
| InChIKey | MLKORXUFSMVSBB-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)