(S)-2-Chloro-1-(3,4-dichlorophenyl)ethanol, 95%
cas: 256474-24-5 — see every product listed under this CAS number, including other names
(S)-2-Chloro-1-(3,4-dichlorophenyl)ethanol, 95% (CAS 256474-24-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 10g, 250mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A510223-100mg |
| cas | 256474-24-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 765.31 Pln | |
| Ambeed | 1g | 3168.31 Pln | |
| Ambeed | 5g | 7696.19 Pln | |
| Ambeed | 10g | 12274.12 Pln | |
| BLDpharm | 100mg | 819.74 Pln | |
| BLDpharm | 250mg | 1480.61 Pln | |
| BLDpharm | 1g | 3407.71 Pln | |
| BLDpharm | 5g | 8289.33 Pln | |
| BLDpharm | 10g | 13226.48 Pln | |
| Chemat | 100mg | 760.40 Pln | |
| Chemat | 250mg | 1379.60 Pln | |
| Chemat | 1g | 3179.60 Pln | |
| Chemat | 5g | 7739.60 Pln | |
| Chemat | 10g | 12342.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(1S)-2-chloro-1-(3,4-dichlorophenyl)ethanol (CAS 256474-24-5) is a chemical compound with the molecular formula C8H7Cl3O and a molecular weight of 225.5 g/mol. IUPAC name: (1S)-2-chloro-1-(3,4-dichlorophenyl)ethanol. InChIKey: LKALNWLBXMXTJS-MRVPVSSYSA-N.
| Molecular formula | C8H7Cl3O |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | (1S)-2-chloro-1-(3,4-dichlorophenyl)ethanol |
| InChIKey | LKALNWLBXMXTJS-MRVPVSSYSA-N |
| SMILES | C1=CC(=C(C=C1[C@@H](CCl)O)Cl)Cl |
Computed by PubChem (NCBI)