Products 6972-47-0
CAS 6972-47-0 is the registry number for 2,4,6-trichloro-3,5-dimethylphenol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,6-trichloro-3,5-dimethylphenol (CAS 6972-47-0) is a chemical compound with the molecular formula C8H7Cl3O and a molecular weight of 225.5 g/mol. IUPAC name: 2,4,6-trichloro-3,5-dimethylphenol. InChIKey: ZNEWEUWJXXZLAD-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3O |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | 2,4,6-trichloro-3,5-dimethylphenol |
| InChIKey | ZNEWEUWJXXZLAD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Cl)O)Cl)C)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,4,6-Trichloro-3,5-dimethylphenol, Phenol, 2,4,6-trichloro-3,5-dimethyl-, 2,4,6-Trichloro-3,5-Dimethyl-Phenol, 3,5-Xylenol, 2,4,6-trichloro-, 3,5-Dimethyl-2,4,6-trichlorophenol, 3, 2,4,6-trichloro-, 2,4,6-Trichlor-3,5-xylenol, 2,4,6-Trichloro-3,5-xylenol, Phenol,4,6-trichloro-3,5-dimethyl-, 2,4,6-Trichloro-3,5-dimethylphenol #