CAS 256474-27-8 is the registry number for (1R)-2-Chloro-1-(3,4-dichlorophenyl)ethan-1-ol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(1R)-2-chloro-1-(3,4-dichlorophenyl)ethanol (CAS 256474-27-8) is a chemical compound with the molecular formula C8H7Cl3O and a molecular weight of 225.5 g/mol. IUPAC name: (1R)-2-chloro-1-(3,4-dichlorophenyl)ethanol. InChIKey: LKALNWLBXMXTJS-QMMMGPOBSA-N.
| Molecular formula | C8H7Cl3O |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | (1R)-2-chloro-1-(3,4-dichlorophenyl)ethanol |
| InChIKey | LKALNWLBXMXTJS-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1[C@H](CCl)O)Cl)Cl |
Computed by PubChem (NCBI)