CAS 168482-77-7 is the registry number for 1-(2,3,4-Trichlorophenyl)ethan-1-ol, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(2,3,4-trichlorophenyl)ethanol (CAS 168482-77-7) is a chemical compound with the molecular formula C8H7Cl3O and a molecular weight of 225.5 g/mol. IUPAC name: 1-(2,3,4-trichlorophenyl)ethanol. InChIKey: YNNJNUFAFGNMQI-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3O |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | 1-(2,3,4-trichlorophenyl)ethanol |
| InChIKey | YNNJNUFAFGNMQI-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C(=C(C=C1)Cl)Cl)Cl)O |
Computed by PubChem (NCBI)