Products 256474-24-5
CAS 256474-24-5 appears in our catalog under these names: (1S)-2-Chloro-1-(3,4-dichlorophenyl)ethan-1-ol, (S)-2-Chloro-1-(3,4-dichlorophenyl)ethanol 95%, (S)-2-Chloro-1-(3,4-dichlorophenyl)ethanol, 95%, 95%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g, 10g.
(1S)-2-chloro-1-(3,4-dichlorophenyl)ethanol (CAS 256474-24-5) is a chemical compound with the molecular formula C8H7Cl3O and a molecular weight of 225.5 g/mol. IUPAC name: (1S)-2-chloro-1-(3,4-dichlorophenyl)ethanol. InChIKey: LKALNWLBXMXTJS-MRVPVSSYSA-N.
| Molecular formula | C8H7Cl3O |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | (1S)-2-chloro-1-(3,4-dichlorophenyl)ethanol |
| InChIKey | LKALNWLBXMXTJS-MRVPVSSYSA-N |
| SMILES | C1=CC(=C(C=C1[C@@H](CCl)O)Cl)Cl |
Computed by PubChem (NCBI)