CAS 126534-31-4 appears in our catalog under these names: (S)–2,4–Dichloro–α–(chloromethyl)benzyl Alcohol, (S)-2,4-Dichloro-±-(chloromethyl)benzyl Alcohol, (S)-2,4-Dichloro-alpha-(chloromethyl)benzyl Alcohol, >98.0%(GC), (S)-alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol 97%, (S)-alpha-(Chloromethyl)-2,4-dichlorobenzyl alcohol, 97%, 97%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 100g, 500g, 25g, 200mg, 1g, 5g, 1kg.
(1S)-2-chloro-1-(2,4-dichlorophenyl)ethanol (CAS 126534-31-4) is a chemical compound with the molecular formula C8H7Cl3O and a molecular weight of 225.5 g/mol. IUPAC name: (1S)-2-chloro-1-(2,4-dichlorophenyl)ethanol. InChIKey: XHEPANNURIQWRM-MRVPVSSYSA-N.
| Molecular formula | C8H7Cl3O |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | (1S)-2-chloro-1-(2,4-dichlorophenyl)ethanol |
| InChIKey | XHEPANNURIQWRM-MRVPVSSYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)[C@@H](CCl)O |
Computed by PubChem (NCBI)