CAS 53065-95-5 appears in our catalog under these names: 2-Chloro-1-(3,4-dichloro-phenyl)-ethanol, 95%, 2-Chloro-1-(3,4-dichlorophenyl)ethanol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-chloro-1-(3,4-dichlorophenyl)ethanol (CAS 53065-95-5) is a chemical compound with the molecular formula C8H7Cl3O and a molecular weight of 225.5 g/mol. IUPAC name: 2-chloro-1-(3,4-dichlorophenyl)ethanol. InChIKey: LKALNWLBXMXTJS-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3O |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | 2-chloro-1-(3,4-dichlorophenyl)ethanol |
| InChIKey | LKALNWLBXMXTJS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(CCl)O)Cl)Cl |
Computed by PubChem (NCBI)