cas: 2222165-17-3 — see every product listed under this CAS number, including other names
(S)-2-Methyl-1-pyridin-2-yl-propylamine dihydrochloride, 98%, 98% (CAS 2222165-17-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DU85-100mg |
| cas | 2222165-17-3 |
| size | 100mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1149.20 Pln | |
| Chemat | 250mg | 1576.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1S)-2-methyl-1-pyridin-2-ylpropan-1-amine;dihydrochloride (CAS 2222165-17-3) is a chemical compound with the molecular formula C9H16Cl2N2 and a molecular weight of 223.14 g/mol. IUPAC name: (1S)-2-methyl-1-pyridin-2-ylpropan-1-amine;dihydrochloride. InChIKey: WQMCWVFMBPRHJX-WWPIYYJJSA-N.
| Molecular formula | C9H16Cl2N2 |
|---|---|
| Molecular weight | 223.14 g/mol |
| IUPAC name | (1S)-2-methyl-1-pyridin-2-ylpropan-1-amine;dihydrochloride |
| InChIKey | WQMCWVFMBPRHJX-WWPIYYJJSA-N |
| SMILES | CC(C)[C@@H](C1=CC=CC=N1)N.Cl.Cl |
Computed by PubChem (NCBI)