cas: 17193-40-7 — see every product listed under this CAS number, including other names
(S)-2-amino-3-(4-nitrophenyl)propanoate hydrochloride, 95%+, 95%+ (CAS 17193-40-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HZK0-5g |
| cas | 17193-40-7 |
| size | 5g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 100g | 266.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride (CAS 17193-40-7) is a chemical compound with the molecular formula C10H13ClN2O4 and a molecular weight of 260.67 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride. InChIKey: BTHMRXRBXYHLRA-FVGYRXGTSA-N.
| Molecular formula | C10H13ClN2O4 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride |
| InChIKey | BTHMRXRBXYHLRA-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)