cas: 17193-40-7 — see every product listed under this CAS number, including other names
4-Nitro-L-phenylalanine methyl ester hydrochloride, 97% (CAS 17193-40-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036597-1G |
| cas | 17193-40-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 96.86 Pln | |
| Fluorochem | 10g | 122.89 Pln | |
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 50g | 310.33 Pln | |
| Fluorochem | 100g | 414.46 Pln | |
| Fluorochem | 500g | 1851.45 Pln | |
| Fluorochem | 1kg | 3652.90 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride (CAS 17193-40-7) is a chemical compound with the molecular formula C10H13ClN2O4 and a molecular weight of 260.67 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride. InChIKey: BTHMRXRBXYHLRA-FVGYRXGTSA-N.
| Molecular formula | C10H13ClN2O4 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride |
| InChIKey | BTHMRXRBXYHLRA-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)