cas: 17193-40-7 — see every product listed under this CAS number, including other names
4-Nitro-L-phenylalanine methyl ester hydrochloride, 99.31% (CAS 17193-40-7) is a chemical reagent available from Chemat. Available pack sizes: 50 g, 100 g, 25 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W002416-50 g |
| cas | 17193-40-7 |
| size | 50 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 g | 505.45 Pln | |
| MedChemExpress | 100 g | 723.72 Pln | |
| MedChemExpress | 25 g | 315.05 Pln | |
| MedChemExpress | 10 g | 240.74 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.31% |
Methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride (CAS 17193-40-7) is a chemical compound with the molecular formula C10H13ClN2O4 and a molecular weight of 260.67 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride. InChIKey: BTHMRXRBXYHLRA-FVGYRXGTSA-N.
| Molecular formula | C10H13ClN2O4 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride |
| InChIKey | BTHMRXRBXYHLRA-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)