cas: 17193-40-7 — see every product listed under this CAS number, including other names
4-Nitro-L-phenylalanine Methyl Ester Hydrochloride, >98.0%(HPLC)(T) (CAS 17193-40-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0878-1G |
| cas | 17193-40-7 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 98.68 Pln | |
| TCI | 5g | 329.79 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
Methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride (CAS 17193-40-7) is a chemical compound with the molecular formula C10H13ClN2O4 and a molecular weight of 260.67 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride. InChIKey: BTHMRXRBXYHLRA-FVGYRXGTSA-N.
| Molecular formula | C10H13ClN2O4 |
|---|---|
| Molecular weight | 260.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-nitrophenyl)propanoate;hydrochloride |
| InChIKey | BTHMRXRBXYHLRA-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)