CAS 209982-91-2 appears in our catalog under these names: (S)-2-(3,5-Difluorophenyl)-2-hydroxyacetic acid 97%, (S)-2-(3,5-Difluorophenyl)-2-Hydroxyacetic Acid, 97%, 97%, Benzeneacetic acid, 3,5-difluoro-hydroxy-, (S)-, (S)-3,5-Difluoromandelic acid, 98%(LC-MS),RG. Offered by: Ambeed, Chemat, Biosynth, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid (CAS 209982-91-2) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: (2S)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid. InChIKey: PHMLPPFFMSRWBK-ZETCQYMHSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | (2S)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid |
| InChIKey | PHMLPPFFMSRWBK-ZETCQYMHSA-N |
| SMILES | C1=C(C=C(C=C1F)F)[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)