CAS 794566-88-4 appears in our catalog under these names: (R)-2-(3,5-Difluorophenyl)-2-hydroxyacetic acid 98%, (R)-2-(3,5-Difluorophenyl)-2-hydroxyacetic acid, 98%, 98%, (R)-2-(3,5-Difluorophenyl)-2-hydroxyacetic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2R)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid (CAS 794566-88-4) is a chemical compound with the molecular formula C8H6F2O3 and a molecular weight of 188.13 g/mol. IUPAC name: (2R)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid. InChIKey: PHMLPPFFMSRWBK-SSDOTTSWSA-N.
| Molecular formula | C8H6F2O3 |
|---|---|
| Molecular weight | 188.13 g/mol |
| IUPAC name | (2R)-2-(3,5-difluorophenyl)-2-hydroxyacetic acid |
| InChIKey | PHMLPPFFMSRWBK-SSDOTTSWSA-N |
| SMILES | C1=C(C=C(C=C1F)F)[C@H](C(=O)O)O |
Computed by PubChem (NCBI)