cas: 158860-18-5 — see every product listed under this CAS number, including other names
(S)-3-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-2-AMINOPROPANOIC ACID, ≥98%, ≥98% (CAS 158860-18-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112QYE-1g |
| cas | 158860-18-5 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 592.40 Pln | |
| Chemat | 10g | 957.20 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 158860-18-5) is a chemical compound with the molecular formula C18H18N2O4 and a molecular weight of 326.3 g/mol. IUPAC name: (2S)-2-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: XRZVCGIEHSZCNU-INIZCTEOSA-N.
| Molecular formula | C18H18N2O4 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | (2S)-2-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | XRZVCGIEHSZCNU-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)