Products 2102858-86-4
CAS 2102858-86-4 is the registry number for 1-tert-Butyl 2-methyl 4-(4-cyanophenyl)-1h-pyrrole-1,2-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-O-tert-butyl 2-O-methyl 4-(4-cyanophenyl)pyrrole-1,2-dicarboxylate (CAS 2102858-86-4) is a chemical compound with the molecular formula C18H18N2O4 and a molecular weight of 326.3 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 4-(4-cyanophenyl)pyrrole-1,2-dicarboxylate. InChIKey: KCRNNQWNLXUSJF-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O4 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl 4-(4-cyanophenyl)pyrrole-1,2-dicarboxylate |
| InChIKey | KCRNNQWNLXUSJF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C=C1C(=O)OC)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)