Products 1820747-13-4

CAS 1820747-13-4 is the registry number for [2-(3-Formyl-benzoylamino)-ethyl]-carbamic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.

Structural formula: {0} (CAS {1})

Benzyl N-[2-[(3-formylbenzoyl)amino]ethyl]carbamate (CAS 1820747-13-4) is a chemical compound with the molecular formula C18H18N2O4 and a molecular weight of 326.3 g/mol. IUPAC name: benzyl N-[2-[(3-formylbenzoyl)amino]ethyl]carbamate. InChIKey: XTZIBCGHNKYRQT-UHFFFAOYSA-N.

Identity
Molecular formulaC18H18N2O4
Molecular weight326.3 g/mol
IUPAC namebenzyl N-[2-[(3-formylbenzoyl)amino]ethyl]carbamate
InChIKeyXTZIBCGHNKYRQT-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)NCCNC(=O)C2=CC=CC(=C2)C=O

Computed by PubChem (NCBI)