CAS 158860-18-5 appears in our catalog under these names: (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-aminopropanoic acid, 95%, (S)-3-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)-2-AMINOPROPANOIC ACID, ≥98%, ≥98%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 1g, 10g.
(2S)-2-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 158860-18-5) is a chemical compound with the molecular formula C18H18N2O4 and a molecular weight of 326.3 g/mol. IUPAC name: (2S)-2-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: XRZVCGIEHSZCNU-INIZCTEOSA-N.
| Molecular formula | C18H18N2O4 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | (2S)-2-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | XRZVCGIEHSZCNU-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)