CAS 744-59-2 appears in our catalog under these names: (S)-2-(2-Benzamidoacetamido)-3-phenylpropanoic acid, 95%, (S)-2-(2-Benzamidoacetamido)-3-phenylpropanoic acid, 98%, 98%, Hippuryl–Phe–OH, Hippuryl-Phe-OH, Hippuryl-L-phenylalanine 99%. Offered by: Combi-blocks, Chemat, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g, 100 mg, 50 mg.
(2S)-2-[(2-benzamidoacetyl)amino]-3-phenylpropanoic acid (CAS 744-59-2) is a chemical compound with the molecular formula C18H18N2O4 and a molecular weight of 326.3 g/mol. IUPAC name: (2S)-2-[(2-benzamidoacetyl)amino]-3-phenylpropanoic acid. InChIKey: CCLJGZGVIQBNDH-HNNXBMFYSA-N.
| Molecular formula | C18H18N2O4 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | (2S)-2-[(2-benzamidoacetyl)amino]-3-phenylpropanoic acid |
| InChIKey | CCLJGZGVIQBNDH-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)CNC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)