CAS 251317-00-7 appears in our catalog under these names: Fmoc-d-dap-oh, 95%, (R)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–3–aminopropanoic acid, Fmoc-D-Dap-OH, Fmoc-D-Dap-OH 95%, Fmoc-D-Dap-OH, 95%, 95%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 25g, 500mg, 100mg.
(2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 251317-00-7) is a chemical compound with the molecular formula C18H18N2O4 and a molecular weight of 326.3 g/mol. IUPAC name: (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: HDSLKWZYHRLRRL-MRXNPFEDSA-N.
| Molecular formula | C18H18N2O4 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | HDSLKWZYHRLRRL-MRXNPFEDSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CN)C(=O)O |
Computed by PubChem (NCBI)