CAS 181954-34-7 appears in our catalog under these names: Fmoc–Dap–OH, Fmoc-L-Dap-OH, Fmoc-Dap-OH 95%, FMOC-DAP-OH, >=97.0%, Fmoc-Dap-OH, 98%, 98%. Offered by: GLPBio, Iris Biotech, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 100g, 25g, 5g, 500g, 250mg, 100mg, 10g.
(2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 181954-34-7) is a chemical compound with the molecular formula C18H18N2O4 and a molecular weight of 326.3 g/mol. IUPAC name: (2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: HDSLKWZYHRLRRL-INIZCTEOSA-N.
| Molecular formula | C18H18N2O4 |
|---|---|
| Molecular weight | 326.3 g/mol |
| IUPAC name | (2S)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | HDSLKWZYHRLRRL-INIZCTEOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CN)C(=O)O |
Computed by PubChem (NCBI)