cas: 500770-84-3 — see every product listed under this CAS number, including other names
(S)-3-((tert-Butoxycarbonyl)amino)-3-(3-nitrophenyl)propanoic acid, 97% (CAS 500770-84-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A145852-250mg |
| cas | 500770-84-3 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 662.41 Pln | |
| AmBeed | 5g | 5460.28 Pln | |
| Fluorochem | 250mg | 1497.41 Pln | |
| Fluorochem | 500mg | 2346.07 Pln | |
| Fluorochem | 1g | 3632.07 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitrophenyl)propanoic acid (CAS 500770-84-3) is a chemical compound with the molecular formula C14H18N2O6 and a molecular weight of 310.30 g/mol. IUPAC name: (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitrophenyl)propanoic acid. InChIKey: VSSDZTCJXHBUGF-NSHDSACASA-N.
| Molecular formula | C14H18N2O6 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-nitrophenyl)propanoic acid |
| InChIKey | VSSDZTCJXHBUGF-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)