CAS 500770-85-4 appears in our catalog under these names: Boc-D-β-Phe(4-NO2)-OH, 97%, (R)-3-Boc-amino-3-(4-nitrophenyl)propionic acid, 95%, (R)-3-Boc-Amino-3-(4-nitrophenyl)propionic acid, 97%, 97%. Offered by: Ambeed, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoic acid (CAS 500770-85-4) is a chemical compound with the molecular formula C14H18N2O6 and a molecular weight of 310.30 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoic acid. InChIKey: JLVLDNCAYKCLCI-LLVKDONJSA-N.
| Molecular formula | C14H18N2O6 |
|---|---|
| Molecular weight | 310.30 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoic acid |
| InChIKey | JLVLDNCAYKCLCI-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)